C8H4Cl2F6OZr — CID 174355043
3,5-bis(trifluoromethyl)phenol;dichlorozirconium (PubChem CID 174355043) has the molecular formula C8H4Cl2F6OZr and a molecular weight of 392.24 g/mol. Its IUPAC name is 3,5-bis(trifluoromethyl)phenol;dichlorozirconium.
| Compound Name | 3,5-bis(trifluoromethyl)phenol;dichlorozirconium |
|---|---|
| PubChem CID | 174355043 |
| Molecular Formula | C8H4Cl2F6OZr |
| Molecular Weight | 392.24 g/mol |
| Exact Mass | 389.86 |
| IUPAC Name | 3,5-bis(trifluoromethyl)phenol;dichlorozirconium |
| SMILES | Cl[Zr]Cl.Oc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C8H4F6O.2ClH.Zr/c9-7(10,11)4-1-5(8(12,13)14)3-6(15)2-4;;;/h1-3,15H;2*1H;/q;;;+2/p-2 |
| InChIKey | CJSVWQLQUVJPCF-UHFFFAOYSA-L |
| XLogP | 4.81 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.24 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |