C14H15F3O2 — CID 743265
(6R)-2,2-dimethyl-6-phenyl-6-(trifluoromethyl)oxan-4-one (PubChem CID 743265) has the molecular formula C14H15F3O2 and a molecular weight of 272.27 g/mol. Its IUPAC name is (6R)-2,2-dimethyl-6-phenyl-6-(trifluoromethyl)oxan-4-one.
| Compound Name | (6R)-2,2-dimethyl-6-phenyl-6-(trifluoromethyl)oxan-4-one |
|---|---|
| PubChem CID | 743265 |
| Molecular Formula | C14H15F3O2 |
| Molecular Weight | 272.27 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | (6R)-2,2-dimethyl-6-phenyl-6-(trifluoromethyl)oxan-4-one |
| SMILES | CC1(C)CC(=O)C[C@@](c2ccccc2)(C(F)(F)F)O1 |
| InChI | InChI=1S/C14H15F3O2/c1-12(2)8-11(18)9-13(19-12,14(15,16)17)10-6-4-3-5-7-10/h3-7H,8-9H2,1-2H3/t13-/m1/s1 |
| InChIKey | ADUYBQMUWKTOQB-CYBMUJFWSA-N |
| XLogP | 3.60 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.27 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |