C17H19Cl2F3OS — CID 162537751
2,2-dichloro-1,1,3,3-tetramethyl-6-phenyl-6-(trifluoromethyl)-5-oxa-8-thiaspiro[3.4]octane (PubChem CID 162537751) has the molecular formula C17H19Cl2F3OS and a molecular weight of 399.31 g/mol. Its IUPAC name is 2,2-dichloro-1,1,3,3-tetramethyl-6-phenyl-6-(trifluoromethyl)-5-oxa-8-thiaspiro[3.4]octane.
| Compound Name | 2,2-dichloro-1,1,3,3-tetramethyl-6-phenyl-6-(trifluoromethyl)-5-oxa-8-thiaspiro[3.4]octane |
|---|---|
| PubChem CID | 162537751 |
| Molecular Formula | C17H19Cl2F3OS |
| Molecular Weight | 399.31 g/mol |
| Exact Mass | 398.05 |
| IUPAC Name | 2,2-dichloro-1,1,3,3-tetramethyl-6-phenyl-6-(trifluoromethyl)-5-oxa-8-thiaspiro[3.4]octane |
| SMILES | CC1(C)C(Cl)(Cl)C(C)(C)C12OC(c1ccccc1)(C(F)(F)F)CS2 |
| InChI | InChI=1S/C17H19Cl2F3OS/c1-12(2)15(18,19)13(3,4)16(12)23-14(10-24-16,17(20,21)22)11-8-6-5-7-9-11/h5-9H,10H2,1-4H3 |
| InChIKey | BGHUJSGSZAVGHW-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.31 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|