C20H20O — CID 135062463
(1S,5R)-5-methyl-1,3-diphenyl-8-oxabicyclo[3.2.1]oct-2-ene (PubChem CID 135062463) has the molecular formula C20H20O and a molecular weight of 276.38 g/mol. Its IUPAC name is (1S,5R)-5-methyl-1,3-diphenyl-8-oxabicyclo[3.2.1]oct-2-ene.
| Compound Name | (1S,5R)-5-methyl-1,3-diphenyl-8-oxabicyclo[3.2.1]oct-2-ene |
|---|---|
| PubChem CID | 135062463 |
| Molecular Formula | C20H20O |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | (1S,5R)-5-methyl-1,3-diphenyl-8-oxabicyclo[3.2.1]oct-2-ene |
| SMILES | C[C@@]12CC[C@@](c3ccccc3)(C=C(c3ccccc3)C1)O2 |
| InChI | InChI=1S/C20H20O/c1-19-12-13-20(21-19,18-10-6-3-7-11-18)15-17(14-19)16-8-4-2-5-9-16/h2-11,15H,12-14H2,1H3/t19-,20+/m1/s1 |
| InChIKey | ISWZMELZHQUWLZ-UXHICEINSA-N |
| XLogP | 4.94 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |