C18H15F3N2O2 — CID 135958981
(NE)-N-[[2-methyl-4-[5-phenyl-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]methylidene]hydroxylamine (PubChem CID 135958981) has the molecular formula C18H15F3N2O2 and a molecular weight of 348.32 g/mol. Its IUPAC name is (NE)-N-[[2-methyl-4-[5-phenyl-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]methylidene]hydroxylamine.
| Compound Name | (NE)-N-[[2-methyl-4-[5-phenyl-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]methylidene]hydroxylamine |
|---|---|
| PubChem CID | 135958981 |
| Molecular Formula | C18H15F3N2O2 |
| Molecular Weight | 348.32 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | (NE)-N-[[2-methyl-4-[5-phenyl-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]methylidene]hydroxylamine |
| SMILES | Cc1cc(C2=NOC(c3ccccc3)(C(F)(F)F)C2)ccc1/C=N/O |
| InChI | InChI=1S/C18H15F3N2O2/c1-12-9-13(7-8-14(12)11-22-24)16-10-17(25-23-16,18(19,20)21)15-5-3-2-4-6-15/h2-9,11,24H,10H2,1H3/b22-11+ |
| InChIKey | VAPJIHYKHIJTQC-SSDVNMTOSA-N |
| XLogP | 4.39 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.32 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|