C15H16ClNO3 — CID 135305780
(6'R)-6'-(3-chloropropyl)spiro[1H-indole-3,2'-oxane]-2,4'-dione (PubChem CID 135305780) has the molecular formula C15H16ClNO3 and a molecular weight of 293.75 g/mol. Its IUPAC name is (6'R)-6'-(3-chloropropyl)spiro[1H-indole-3,2'-oxane]-2,4'-dione.
| Compound Name | (6'R)-6'-(3-chloropropyl)spiro[1H-indole-3,2'-oxane]-2,4'-dione |
|---|---|
| PubChem CID | 135305780 |
| Molecular Formula | C15H16ClNO3 |
| Molecular Weight | 293.75 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | (6'R)-6'-(3-chloropropyl)spiro[1H-indole-3,2'-oxane]-2,4'-dione |
| SMILES | O=C1C[C@@H](CCCCl)OC2(C1)C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C15H16ClNO3/c16-7-3-4-11-8-10(18)9-15(20-11)12-5-1-2-6-13(12)17-14(15)19/h1-2,5-6,11H,3-4,7-9H2,(H,17,19)/t11-,15?/m1/s1 |
| InChIKey | OPCYZAJVONRNOD-ZRKZCGFPSA-N |
| XLogP | 2.60 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.75 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|