C23H23NO3 — CID 139218217
(1'S,3R)-1'-(phenylmethoxymethyl)spiro[1H-indole-3,3'-4,5,6,7-tetrahydro-1H-cyclopenta[c]pyran]-2-one (PubChem CID 139218217) has the molecular formula C23H23NO3 and a molecular weight of 361.44 g/mol. Its IUPAC name is (1'S,3R)-1'-(phenylmethoxymethyl)spiro[1H-indole-3,3'-4,5,6,7-tetrahydro-1H-cyclopenta[c]pyran]-2-one.
| Compound Name | (1'S,3R)-1'-(phenylmethoxymethyl)spiro[1H-indole-3,3'-4,5,6,7-tetrahydro-1H-cyclopenta[c]pyran]-2-one |
|---|---|
| PubChem CID | 139218217 |
| Molecular Formula | C23H23NO3 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | (1'S,3R)-1'-(phenylmethoxymethyl)spiro[1H-indole-3,3'-4,5,6,7-tetrahydro-1H-cyclopenta[c]pyran]-2-one |
| SMILES | O=C1Nc2ccccc2[C@]12CC1=C(CCC1)[C@@H](COCc1ccccc1)O2 |
| InChI | InChI=1S/C23H23NO3/c25-22-23(19-11-4-5-12-20(19)24-22)13-17-9-6-10-18(17)21(27-23)15-26-14-16-7-2-1-3-8-16/h1-5,7-8,11-12,21H,6,9-10,13-15H2,(H,24,25)/t21-,23-/m1/s1 |
| InChIKey | YYBPKURGZOUAER-FYYLOGMGSA-N |
| XLogP | 4.32 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|