C21H20BrNO3 — CID 75307835
4-bromo-4'-methyl-2'-(phenylmethoxymethyl)spiro[1H-indole-3,6'-2,5-dihydropyran]-2-one (PubChem CID 75307835) has the molecular formula C21H20BrNO3 and a molecular weight of 414.30 g/mol. Its IUPAC name is 4-bromo-4'-methyl-2'-(phenylmethoxymethyl)spiro[1H-indole-3,6'-2,5-dihydropyran]-2-one.
| Compound Name | 4-bromo-4'-methyl-2'-(phenylmethoxymethyl)spiro[1H-indole-3,6'-2,5-dihydropyran]-2-one |
|---|---|
| PubChem CID | 75307835 |
| Molecular Formula | C21H20BrNO3 |
| Molecular Weight | 414.30 g/mol |
| Exact Mass | 413.06 |
| IUPAC Name | 4-bromo-4'-methyl-2'-(phenylmethoxymethyl)spiro[1H-indole-3,6'-2,5-dihydropyran]-2-one |
| SMILES | CC1=CC(COCc2ccccc2)OC2(C1)C(=O)Nc1cccc(Br)c12 |
| InChI | InChI=1S/C21H20BrNO3/c1-14-10-16(13-25-12-15-6-3-2-4-7-15)26-21(11-14)19-17(22)8-5-9-18(19)23-20(21)24/h2-10,16H,11-13H2,1H3,(H,23,24) |
| InChIKey | XUVNTVYKXBTGGX-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.30 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|