C16H15BrO3 — CID 57251845
5-bromo-2-(phenylmethoxymethyl)-4H-1,3-benzodioxine (PubChem CID 57251845) has the molecular formula C16H15BrO3 and a molecular weight of 335.20 g/mol. Its IUPAC name is 5-bromo-2-(phenylmethoxymethyl)-4H-1,3-benzodioxine.
| Compound Name | 5-bromo-2-(phenylmethoxymethyl)-4H-1,3-benzodioxine |
|---|---|
| PubChem CID | 57251845 |
| Molecular Formula | C16H15BrO3 |
| Molecular Weight | 335.20 g/mol |
| Exact Mass | 334.02 |
| IUPAC Name | 5-bromo-2-(phenylmethoxymethyl)-4H-1,3-benzodioxine |
| SMILES | Brc1cccc2c1COC(COCc1ccccc1)O2 |
| InChI | InChI=1S/C16H15BrO3/c17-14-7-4-8-15-13(14)10-19-16(20-15)11-18-9-12-5-2-1-3-6-12/h1-8,16H,9-11H2 |
| InChIKey | KTACDVXAAXSRGF-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.20 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |