C12H13NO3 — CID 175256880
6-(phenylmethoxymethyl)-4-oxa-1-azabicyclo[3.1.0]hexan-2-one (PubChem CID 175256880) has the molecular formula C12H13NO3 and a molecular weight of 219.24 g/mol. Its IUPAC name is 6-(phenylmethoxymethyl)-4-oxa-1-azabicyclo[3.1.0]hexan-2-one.
| Compound Name | 6-(phenylmethoxymethyl)-4-oxa-1-azabicyclo[3.1.0]hexan-2-one |
|---|---|
| PubChem CID | 175256880 |
| Molecular Formula | C12H13NO3 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | 6-(phenylmethoxymethyl)-4-oxa-1-azabicyclo[3.1.0]hexan-2-one |
| SMILES | O=C1COC2C(COCc3ccccc3)N12 |
| InChI | InChI=1S/C12H13NO3/c14-11-8-16-12-10(13(11)12)7-15-6-9-4-2-1-3-5-9/h1-5,10,12H,6-8H2 |
| InChIKey | WRDNFNCNTAHDJK-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 38.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|