C24H27NO3 — CID 90180936
(2S,3S,5R)-3-phenylmethoxy-2-(phenylmethoxymethyl)-6-propan-2-ylidene-1-azabicyclo[3.2.0]heptan-7-one (PubChem CID 90180936) has the molecular formula C24H27NO3 and a molecular weight of 377.48 g/mol. Its IUPAC name is (2S,3S,5R)-3-phenylmethoxy-2-(phenylmethoxymethyl)-6-propan-2-ylidene-1-azabicyclo[3.2.0]heptan-7-one.
| Compound Name | (2S,3S,5R)-3-phenylmethoxy-2-(phenylmethoxymethyl)-6-propan-2-ylidene-1-azabicyclo[3.2.0]heptan-7-one |
|---|---|
| PubChem CID | 90180936 |
| Molecular Formula | C24H27NO3 |
| Molecular Weight | 377.48 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | (2S,3S,5R)-3-phenylmethoxy-2-(phenylmethoxymethyl)-6-propan-2-ylidene-1-azabicyclo[3.2.0]heptan-7-one |
| SMILES | CC(C)=C1C(=O)N2[C@@H]1C[C@H](OCc1ccccc1)[C@@H]2COCc1ccccc1 |
| InChI | InChI=1S/C24H27NO3/c1-17(2)23-20-13-22(28-15-19-11-7-4-8-12-19)21(25(20)24(23)26)16-27-14-18-9-5-3-6-10-18/h3-12,20-22H,13-16H2,1-2H3/t20-,21+,22+/m1/s1 |
| InChIKey | XXJAWIIUIYRFCL-FSSWDIPSSA-N |
| XLogP | 4.11 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.48 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|