C31H33NO4 — CID 42640032
(6S,7S,8R,9aS)-7,8-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-1,6,7,8,9,9a-hexahydroquinolizin-4-one (PubChem CID 42640032) has the molecular formula C31H33NO4 and a molecular weight of 483.61 g/mol. Its IUPAC name is (6S,7S,8R,9aS)-7,8-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-1,6,7,8,9,9a-hexahydroquinolizin-4-one.
| Compound Name | (6S,7S,8R,9aS)-7,8-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-1,6,7,8,9,9a-hexahydroquinolizin-4-one |
|---|---|
| PubChem CID | 42640032 |
| Molecular Formula | C31H33NO4 |
| Molecular Weight | 483.61 g/mol |
| Exact Mass | 483.24 |
| IUPAC Name | (6S,7S,8R,9aS)-7,8-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-1,6,7,8,9,9a-hexahydroquinolizin-4-one |
| SMILES | O=C1C=CC[C@H]2C[C@@H](OCc3ccccc3)[C@@H](OCc3ccccc3)[C@H](COCc3ccccc3)N12 |
| InChI | InChI=1S/C31H33NO4/c33-30-18-10-17-27-19-29(35-21-25-13-6-2-7-14-25)31(36-22-26-15-8-3-9-16-26)28(32(27)30)23-34-20-24-11-4-1-5-12-24/h1-16,18,27-29,31H,17,19-23H2/t27-,28-,29+,31-/m0/s1 |
| InChIKey | SXFUSMLGHNGELK-AKTOALFRSA-N |
| XLogP | 5.30 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.61 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |