C24H33NO4 — CID 169438097
(3R,4R)-1-butyl-5-phenylmethoxy-2-(phenylmethoxymethyl)piperidine-3,4-diol (PubChem CID 169438097) has the molecular formula C24H33NO4 and a molecular weight of 399.53 g/mol. Its IUPAC name is (3R,4R)-1-butyl-5-phenylmethoxy-2-(phenylmethoxymethyl)piperidine-3,4-diol.
| Compound Name | (3R,4R)-1-butyl-5-phenylmethoxy-2-(phenylmethoxymethyl)piperidine-3,4-diol |
|---|---|
| PubChem CID | 169438097 |
| Molecular Formula | C24H33NO4 |
| Molecular Weight | 399.53 g/mol |
| Exact Mass | 399.24 |
| IUPAC Name | (3R,4R)-1-butyl-5-phenylmethoxy-2-(phenylmethoxymethyl)piperidine-3,4-diol |
| SMILES | CCCCN1CC(OCc2ccccc2)[C@H](O)[C@H](O)C1COCc1ccccc1 |
| InChI | InChI=1S/C24H33NO4/c1-2-3-14-25-15-22(29-17-20-12-8-5-9-13-20)24(27)23(26)21(25)18-28-16-19-10-6-4-7-11-19/h4-13,21-24,26-27H,2-3,14-18H2,1H3/t21?,22?,23-,24+/m1/s1 |
| InChIKey | VUGUTIOWLDKZBP-ZQHBMWIYSA-N |
| XLogP | 2.99 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.53 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |