C17H27NO4 — CID 175678790
1-butyl-2-(hydroxymethyl)-5-phenylmethoxypiperidine-3,4-diol (PubChem CID 175678790) has the molecular formula C17H27NO4 and a molecular weight of 309.41 g/mol. Its IUPAC name is 1-butyl-2-(hydroxymethyl)-5-phenylmethoxypiperidine-3,4-diol.
| Compound Name | 1-butyl-2-(hydroxymethyl)-5-phenylmethoxypiperidine-3,4-diol |
|---|---|
| PubChem CID | 175678790 |
| Molecular Formula | C17H27NO4 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | 1-butyl-2-(hydroxymethyl)-5-phenylmethoxypiperidine-3,4-diol |
| SMILES | CCCCN1CC(OCc2ccccc2)C(O)C(O)C1CO |
| InChI | InChI=1S/C17H27NO4/c1-2-3-9-18-10-15(17(21)16(20)14(18)11-19)22-12-13-7-5-4-6-8-13/h4-8,14-17,19-21H,2-3,9-12H2,1H3 |
| InChIKey | JAMYICQVLQRZIA-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 73.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |