C11H23NO4 — CID 173374212
(3R,4R,5S)-2-(hydroxymethyl)-1-pentylpiperidine-3,4,5-triol (PubChem CID 173374212) has the molecular formula C11H23NO4 and a molecular weight of 233.31 g/mol. Its IUPAC name is (3R,4R,5S)-2-(hydroxymethyl)-1-pentylpiperidine-3,4,5-triol.
| Compound Name | (3R,4R,5S)-2-(hydroxymethyl)-1-pentylpiperidine-3,4,5-triol |
|---|---|
| PubChem CID | 173374212 |
| Molecular Formula | C11H23NO4 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.16 |
| IUPAC Name | (3R,4R,5S)-2-(hydroxymethyl)-1-pentylpiperidine-3,4,5-triol |
| SMILES | CCCCCN1C[C@H](O)[C@@H](O)[C@H](O)C1CO |
| InChI | InChI=1S/C11H23NO4/c1-2-3-4-5-12-6-9(14)11(16)10(15)8(12)7-13/h8-11,13-16H,2-7H2,1H3/t8?,9-,10+,11+/m0/s1 |
| InChIKey | HCZQIIVHWYFIPW-NVEZCULWSA-N |
| XLogP | -1.06 |
| TPSA | 84.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|