C15H30ClNO3 — CID 173327207
(3R,4S,5S)-5-chloro-2-(hydroxymethyl)-1-nonylpiperidine-3,4-diol (PubChem CID 173327207) has the molecular formula C15H30ClNO3 and a molecular weight of 307.86 g/mol. Its IUPAC name is (3R,4S,5S)-5-chloro-2-(hydroxymethyl)-1-nonylpiperidine-3,4-diol.
| Compound Name | (3R,4S,5S)-5-chloro-2-(hydroxymethyl)-1-nonylpiperidine-3,4-diol |
|---|---|
| PubChem CID | 173327207 |
| Molecular Formula | C15H30ClNO3 |
| Molecular Weight | 307.86 g/mol |
| Exact Mass | 307.19 |
| IUPAC Name | (3R,4S,5S)-5-chloro-2-(hydroxymethyl)-1-nonylpiperidine-3,4-diol |
| SMILES | CCCCCCCCCN1C[C@H](Cl)[C@@H](O)[C@H](O)C1CO |
| InChI | InChI=1S/C15H30ClNO3/c1-2-3-4-5-6-7-8-9-17-10-12(16)14(19)15(20)13(17)11-18/h12-15,18-20H,2-11H2,1H3/t12-,13?,14+,15+/m0/s1 |
| InChIKey | XEVIRJFPEOYRRO-LJKOUDNXSA-N |
| XLogP | 1.74 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.86 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|