C13H27NO5 — CID 75151866
1-hexyl-2,6-bis(hydroxymethyl)piperidine-3,4,5-triol (PubChem CID 75151866) has the molecular formula C13H27NO5 and a molecular weight of 277.36 g/mol. Its IUPAC name is 1-hexyl-2,6-bis(hydroxymethyl)piperidine-3,4,5-triol.
| Compound Name | 1-hexyl-2,6-bis(hydroxymethyl)piperidine-3,4,5-triol |
|---|---|
| PubChem CID | 75151866 |
| Molecular Formula | C13H27NO5 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.19 |
| IUPAC Name | 1-hexyl-2,6-bis(hydroxymethyl)piperidine-3,4,5-triol |
| SMILES | CCCCCCN1C(CO)C(O)C(O)C(O)C1CO |
| InChI | InChI=1S/C13H27NO5/c1-2-3-4-5-6-14-9(7-15)11(17)13(19)12(18)10(14)8-16/h9-13,15-19H,2-8H2,1H3 |
| InChIKey | FRSCBFYZDMYTCV-UHFFFAOYSA-N |
| XLogP | -1.31 |
| TPSA | 104.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|