C15H31NO4 — CID 46200068
(2S,3S,4S,5S)-2,5-bis(hydroxymethyl)-1-nonylpyrrolidine-3,4-diol (PubChem CID 46200068) has the molecular formula C15H31NO4 and a molecular weight of 289.42 g/mol. Its IUPAC name is (2S,3S,4S,5S)-2,5-bis(hydroxymethyl)-1-nonylpyrrolidine-3,4-diol.
| Compound Name | (2S,3S,4S,5S)-2,5-bis(hydroxymethyl)-1-nonylpyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 46200068 |
| Molecular Formula | C15H31NO4 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.23 |
| IUPAC Name | (2S,3S,4S,5S)-2,5-bis(hydroxymethyl)-1-nonylpyrrolidine-3,4-diol |
| SMILES | CCCCCCCCCN1[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]1CO |
| InChI | InChI=1S/C15H31NO4/c1-2-3-4-5-6-7-8-9-16-12(10-17)14(19)15(20)13(16)11-18/h12-15,17-20H,2-11H2,1H3/t12-,13-,14-,15-/m0/s1 |
| InChIKey | IIRGHBHREUJPQU-AJNGGQMLSA-N |
| XLogP | 0.50 |
| TPSA | 84.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|