C15H30N2O4S — CID 134155281
(2S,3S,4S,5S)-3,4-dihydroxy-2,5-bis(hydroxymethyl)-N-octylpyrrolidine-1-carbothioamide (PubChem CID 134155281) has the molecular formula C15H30N2O4S and a molecular weight of 334.48 g/mol. Its IUPAC name is (2S,3S,4S,5S)-3,4-dihydroxy-2,5-bis(hydroxymethyl)-N-octylpyrrolidine-1-carbothioamide.
| Compound Name | (2S,3S,4S,5S)-3,4-dihydroxy-2,5-bis(hydroxymethyl)-N-octylpyrrolidine-1-carbothioamide |
|---|---|
| PubChem CID | 134155281 |
| Molecular Formula | C15H30N2O4S |
| Molecular Weight | 334.48 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | (2S,3S,4S,5S)-3,4-dihydroxy-2,5-bis(hydroxymethyl)-N-octylpyrrolidine-1-carbothioamide |
| SMILES | CCCCCCCCNC(=S)N1[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]1CO |
| InChI | InChI=1S/C15H30N2O4S/c1-2-3-4-5-6-7-8-16-15(22)17-11(9-18)13(20)14(21)12(17)10-19/h11-14,18-21H,2-10H2,1H3,(H,16,22)/t11-,12-,13-,14-/m0/s1 |
| InChIKey | XNRSYFIJRFLOFG-XUXIUFHCSA-N |
| XLogP | -0.02 |
| TPSA | 96.19 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.48 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|