C13H25N3O4S — CID 134148690
N-[(3S,4S,5R,6R)-1-(butylcarbamothioyl)-4,5-dihydroxy-6-(hydroxymethyl)piperidin-3-yl]acetamide (PubChem CID 134148690) has the molecular formula C13H25N3O4S and a molecular weight of 319.43 g/mol. Its IUPAC name is N-[(3S,4S,5R,6R)-1-(butylcarbamothioyl)-4,5-dihydroxy-6-(hydroxymethyl)piperidin-3-yl]acetamide.
| Compound Name | N-[(3S,4S,5R,6R)-1-(butylcarbamothioyl)-4,5-dihydroxy-6-(hydroxymethyl)piperidin-3-yl]acetamide |
|---|---|
| PubChem CID | 134148690 |
| Molecular Formula | C13H25N3O4S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | N-[(3S,4S,5R,6R)-1-(butylcarbamothioyl)-4,5-dihydroxy-6-(hydroxymethyl)piperidin-3-yl]acetamide |
| SMILES | CCCCNC(=S)N1C[C@H](NC(C)=O)[C@H](O)[C@H](O)[C@H]1CO |
| InChI | InChI=1S/C13H25N3O4S/c1-3-4-5-14-13(21)16-6-9(15-8(2)18)11(19)12(20)10(16)7-17/h9-12,17,19-20H,3-7H2,1-2H3,(H,14,21)(H,15,18)/t9-,10+,11-,12+/m0/s1 |
| InChIKey | ZTLWCGULEPATOC-WHOHXGKFSA-N |
| XLogP | -1.44 |
| TPSA | 105.06 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|