C18H36N2S — CID 98157750
(2S,6S)-N-decyl-2,6-dimethylpiperidine-1-carbothioamide (PubChem CID 98157750) has the molecular formula C18H36N2S and a molecular weight of 312.57 g/mol. Its IUPAC name is (2S,6S)-N-decyl-2,6-dimethylpiperidine-1-carbothioamide.
| Compound Name | (2S,6S)-N-decyl-2,6-dimethylpiperidine-1-carbothioamide |
|---|---|
| PubChem CID | 98157750 |
| Molecular Formula | C18H36N2S |
| Molecular Weight | 312.57 g/mol |
| Exact Mass | 312.26 |
| IUPAC Name | (2S,6S)-N-decyl-2,6-dimethylpiperidine-1-carbothioamide |
| SMILES | CCCCCCCCCCNC(=S)N1[C@@H](C)CCC[C@@H]1C |
| InChI | InChI=1S/C18H36N2S/c1-4-5-6-7-8-9-10-11-15-19-18(21)20-16(2)13-12-14-17(20)3/h16-17H,4-15H2,1-3H3,(H,19,21)/t16-,17-/m0/s1 |
| InChIKey | IVDHRGNKLIOQMM-IRXDYDNUSA-N |
| XLogP | 5.26 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.57 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|