C21H27NO4 — CID 53230988
(2R,3R,4R)-2-(hydroxymethyl)-4-phenylmethoxy-1-(2-phenylmethoxyethyl)pyrrolidin-3-ol (PubChem CID 53230988) has the molecular formula C21H27NO4 and a molecular weight of 357.45 g/mol. Its IUPAC name is (2R,3R,4R)-2-(hydroxymethyl)-4-phenylmethoxy-1-(2-phenylmethoxyethyl)pyrrolidin-3-ol.
| Compound Name | (2R,3R,4R)-2-(hydroxymethyl)-4-phenylmethoxy-1-(2-phenylmethoxyethyl)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 53230988 |
| Molecular Formula | C21H27NO4 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | (2R,3R,4R)-2-(hydroxymethyl)-4-phenylmethoxy-1-(2-phenylmethoxyethyl)pyrrolidin-3-ol |
| SMILES | OC[C@@H]1[C@@H](O)[C@H](OCc2ccccc2)CN1CCOCc1ccccc1 |
| InChI | InChI=1S/C21H27NO4/c23-14-19-21(24)20(26-16-18-9-5-2-6-10-18)13-22(19)11-12-25-15-17-7-3-1-4-8-17/h1-10,19-21,23-24H,11-16H2/t19-,20-,21-/m1/s1 |
| InChIKey | LHPDIUPMOZGTJW-NJDAHSKKSA-N |
| XLogP | 1.83 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|