C36H51NO4Si — CID 173332644
(3R,4S,5S)-4,5-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-1-(6-trimethylsilylhexyl)piperidin-3-ol (PubChem CID 173332644) has the molecular formula C36H51NO4Si and a molecular weight of 589.89 g/mol. Its IUPAC name is (3R,4S,5S)-4,5-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-1-(6-trimethylsilylhexyl)piperidin-3-ol.
| Compound Name | (3R,4S,5S)-4,5-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-1-(6-trimethylsilylhexyl)piperidin-3-ol |
|---|---|
| PubChem CID | 173332644 |
| Molecular Formula | C36H51NO4Si |
| Molecular Weight | 589.89 g/mol |
| Exact Mass | 589.36 |
| IUPAC Name | (3R,4S,5S)-4,5-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-1-(6-trimethylsilylhexyl)piperidin-3-ol |
| SMILES | C[Si](C)(C)CCCCCCN1C[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](O)C1COCc1ccccc1 |
| InChI | InChI=1S/C36H51NO4Si/c1-42(2,3)24-16-5-4-15-23-37-25-34(40-27-31-19-11-7-12-20-31)36(41-28-32-21-13-8-14-22-32)35(38)33(37)29-39-26-30-17-9-6-10-18-30/h6-14,17-22,33-36,38H,4-5,15-16,23-29H2,1-3H3/t33?,34-,35+,36+/m0/s1 |
| InChIKey | OVYVHVOZPIWBCN-QMYLHGGXSA-N |
| XLogP | 7.32 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.89 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|