C25H34N2O — CID 23661083
(1R,2R,5S)-6-benzyl-8-butyl-2-phenylmethoxy-6,8-diazabicyclo[3.2.2]nonane (PubChem CID 23661083) has the molecular formula C25H34N2O and a molecular weight of 378.56 g/mol. Its IUPAC name is (1R,2R,5S)-6-benzyl-8-butyl-2-phenylmethoxy-6,8-diazabicyclo[3.2.2]nonane.
| Compound Name | (1R,2R,5S)-6-benzyl-8-butyl-2-phenylmethoxy-6,8-diazabicyclo[3.2.2]nonane |
|---|---|
| PubChem CID | 23661083 |
| Molecular Formula | C25H34N2O |
| Molecular Weight | 378.56 g/mol |
| Exact Mass | 378.27 |
| IUPAC Name | (1R,2R,5S)-6-benzyl-8-butyl-2-phenylmethoxy-6,8-diazabicyclo[3.2.2]nonane |
| SMILES | CCCCN1C[C@@H]2CC[C@@H](OCc3ccccc3)[C@H]1CN2Cc1ccccc1 |
| InChI | InChI=1S/C25H34N2O/c1-2-3-16-26-18-23-14-15-25(28-20-22-12-8-5-9-13-22)24(26)19-27(23)17-21-10-6-4-7-11-21/h4-13,23-25H,2-3,14-20H2,1H3/t23-,24+,25+/m0/s1 |
| InChIKey | BAWRLAUIQOALAY-ISJGIBHGSA-N |
| XLogP | 4.72 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.56 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |