C12H14O5 — CID 177185442
(4R)-2-(phenylmethoxymethyl)-1,3-dioxolane-4-carboxylic acid (PubChem CID 177185442) has the molecular formula C12H14O5 and a molecular weight of 238.24 g/mol. Its IUPAC name is (4R)-2-(phenylmethoxymethyl)-1,3-dioxolane-4-carboxylic acid.
| Compound Name | (4R)-2-(phenylmethoxymethyl)-1,3-dioxolane-4-carboxylic acid |
|---|---|
| PubChem CID | 177185442 |
| Molecular Formula | C12H14O5 |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | (4R)-2-(phenylmethoxymethyl)-1,3-dioxolane-4-carboxylic acid |
| SMILES | O=C(O)[C@H]1COC(COCc2ccccc2)O1 |
| InChI | InChI=1S/C12H14O5/c13-12(14)10-7-16-11(17-10)8-15-6-9-4-2-1-3-5-9/h1-5,10-11H,6-8H2,(H,13,14)/t10-,11?/m1/s1 |
| InChIKey | PMNXFGFKUAEZES-NFJWQWPMSA-N |
| XLogP | 1.03 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |