About (2S,4R)-2-(hydroxymethyl)-1,3-dioxolane-4-carboxylic acid
(2S,4R)-2-(hydroxymethyl)-1,3-dioxolane-4-carboxylic acid (PubChem CID 177185447) has the molecular formula C5H8O5
and a molecular weight of 148.11 g/mol. Its IUPAC name is (2S,4R)-2-(hydroxymethyl)-1,3-dioxolane-4-carboxylic acid.
Analyze (2S,4R)-2-(hydroxymethyl)-1,3-dioxolane-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,4R)-2-(hydroxymethyl)-1,3-dioxolane-4-carboxylic acid?
The IUPAC name of (2S,4R)-2-(hydroxymethyl)-1,3-dioxolane-4-carboxylic acid (CID 177185447) is (2S,4R)-2-(hydroxymethyl)-1,3-dioxolane-4-carboxylic acid.
What is the SMILES notation for (2S,4R)-2-(hydroxymethyl)-1,3-dioxolane-4-carboxylic acid?
The canonical SMILES for (2S,4R)-2-(hydroxymethyl)-1,3-dioxolane-4-carboxylic acid is O=C(O)[C@H]1CO[C@H](CO)O1.
What is the InChIKey of (2S,4R)-2-(hydroxymethyl)-1,3-dioxolane-4-carboxylic acid?
The InChIKey is QTUWYITVQZYCQT-DMTCNVIQSA-N. The full InChI is InChI=1S/C5H8O5/c6-1-4-9-2-3(10-4)5(7)8/h3-4,6H,1-2H2,(H,7,8)/t3-,4+/m1/s1.
What are the key properties of (2S,4R)-2-(hydroxymethyl)-1,3-dioxolane-4-carboxylic acid?
(2S,4R)-2-(hydroxymethyl)-1,3-dioxolane-4-carboxylic acid has a molecular weight of 148.11 g/mol, XLogP of -1.20, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,4R)-2-(hydroxymethyl)-1,3-dioxolane-4-carboxylic acid is sourced from PubChem (CID 177185447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).