C11H13IO3 — CID 11034542
(2S,4R)-4-iodo-2-(phenylmethoxymethyl)-1,3-dioxolane (PubChem CID 11034542) has the molecular formula C11H13IO3 and a molecular weight of 320.13 g/mol. Its IUPAC name is (2S,4R)-4-iodo-2-(phenylmethoxymethyl)-1,3-dioxolane.
| Compound Name | (2S,4R)-4-iodo-2-(phenylmethoxymethyl)-1,3-dioxolane |
|---|---|
| PubChem CID | 11034542 |
| Molecular Formula | C11H13IO3 |
| Molecular Weight | 320.13 g/mol |
| Exact Mass | 319.99 |
| IUPAC Name | (2S,4R)-4-iodo-2-(phenylmethoxymethyl)-1,3-dioxolane |
| SMILES | I[C@@H]1CO[C@H](COCc2ccccc2)O1 |
| InChI | InChI=1S/C11H13IO3/c12-10-7-14-11(15-10)8-13-6-9-4-2-1-3-5-9/h1-5,10-11H,6-8H2/t10-,11-/m0/s1 |
| InChIKey | DXDKNXZHNFHOOK-QWRGUYRKSA-N |
| XLogP | 2.34 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.13 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|