C23H24O4 — CID 101128231
(2S,6S)-4-phenylmethoxy-2-(phenylmethoxymethyl)-6-prop-2-enyl-2H-pyran-5-one (PubChem CID 101128231) has the molecular formula C23H24O4 and a molecular weight of 364.44 g/mol. Its IUPAC name is (2S,6S)-4-phenylmethoxy-2-(phenylmethoxymethyl)-6-prop-2-enyl-2H-pyran-5-one.
| Compound Name | (2S,6S)-4-phenylmethoxy-2-(phenylmethoxymethyl)-6-prop-2-enyl-2H-pyran-5-one |
|---|---|
| PubChem CID | 101128231 |
| Molecular Formula | C23H24O4 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | (2S,6S)-4-phenylmethoxy-2-(phenylmethoxymethyl)-6-prop-2-enyl-2H-pyran-5-one |
| SMILES | C=CC[C@@H]1O[C@H](COCc2ccccc2)C=C(OCc2ccccc2)C1=O |
| InChI | InChI=1S/C23H24O4/c1-2-9-21-23(24)22(26-16-19-12-7-4-8-13-19)14-20(27-21)17-25-15-18-10-5-3-6-11-18/h2-8,10-14,20-21H,1,9,15-17H2/t20-,21-/m0/s1 |
| InChIKey | FVHRJWZROYKMMX-SFTDATJTSA-N |
| XLogP | 4.22 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|