C17H24O2 — CID 102008593
(1S,2S,3R)-3-(phenylmethoxymethyl)-2-prop-2-enylcyclohexan-1-ol (PubChem CID 102008593) has the molecular formula C17H24O2 and a molecular weight of 260.38 g/mol. Its IUPAC name is (1S,2S,3R)-3-(phenylmethoxymethyl)-2-prop-2-enylcyclohexan-1-ol.
| Compound Name | (1S,2S,3R)-3-(phenylmethoxymethyl)-2-prop-2-enylcyclohexan-1-ol |
|---|---|
| PubChem CID | 102008593 |
| Molecular Formula | C17H24O2 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | (1S,2S,3R)-3-(phenylmethoxymethyl)-2-prop-2-enylcyclohexan-1-ol |
| SMILES | C=CC[C@H]1[C@H](COCc2ccccc2)CCC[C@@H]1O |
| InChI | InChI=1S/C17H24O2/c1-2-7-16-15(10-6-11-17(16)18)13-19-12-14-8-4-3-5-9-14/h2-5,8-9,15-18H,1,6-7,10-13H2/t15-,16-,17-/m0/s1 |
| InChIKey | UMDGDWMHSGRGHB-ULQDDVLXSA-N |
| XLogP | 3.56 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|