C15H18O2S — CID 14373651
5-(phenylmethoxymethyl)-3-prop-2-enyloxolane-2-thione (PubChem CID 14373651) has the molecular formula C15H18O2S and a molecular weight of 262.37 g/mol. Its IUPAC name is 5-(phenylmethoxymethyl)-3-prop-2-enyloxolane-2-thione.
| Compound Name | 5-(phenylmethoxymethyl)-3-prop-2-enyloxolane-2-thione |
|---|---|
| PubChem CID | 14373651 |
| Molecular Formula | C15H18O2S |
| Molecular Weight | 262.37 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | 5-(phenylmethoxymethyl)-3-prop-2-enyloxolane-2-thione |
| SMILES | C=CCC1CC(COCc2ccccc2)OC1=S |
| InChI | InChI=1S/C15H18O2S/c1-2-6-13-9-14(17-15(13)18)11-16-10-12-7-4-3-5-8-12/h2-5,7-8,13-14H,1,6,9-11H2 |
| InChIKey | WVRKKOKXAPMZER-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.37 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|