C15H18O3 — CID 14667665
(4S,6R)-4-ethenyl-6-(phenylmethoxymethyl)oxan-2-one (PubChem CID 14667665) has the molecular formula C15H18O3 and a molecular weight of 246.31 g/mol. Its IUPAC name is (4S,6R)-4-ethenyl-6-(phenylmethoxymethyl)oxan-2-one.
| Compound Name | (4S,6R)-4-ethenyl-6-(phenylmethoxymethyl)oxan-2-one |
|---|---|
| PubChem CID | 14667665 |
| Molecular Formula | C15H18O3 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | (4S,6R)-4-ethenyl-6-(phenylmethoxymethyl)oxan-2-one |
| SMILES | C=C[C@@H]1CC(=O)O[C@@H](COCc2ccccc2)C1 |
| InChI | InChI=1S/C15H18O3/c1-2-12-8-14(18-15(16)9-12)11-17-10-13-6-4-3-5-7-13/h2-7,12,14H,1,8-11H2/t12-,14+/m0/s1 |
| InChIKey | PLWQAJVBVYOAFO-GXTWGEPZSA-N |
| XLogP | 2.71 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|