C17H22O2S — CID 134920499
3-(2-methylbut-3-en-2-yl)-5-(phenylmethoxymethyl)oxolane-2-thione (PubChem CID 134920499) has the molecular formula C17H22O2S and a molecular weight of 290.43 g/mol. Its IUPAC name is 3-(2-methylbut-3-en-2-yl)-5-(phenylmethoxymethyl)oxolane-2-thione.
| Compound Name | 3-(2-methylbut-3-en-2-yl)-5-(phenylmethoxymethyl)oxolane-2-thione |
|---|---|
| PubChem CID | 134920499 |
| Molecular Formula | C17H22O2S |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 3-(2-methylbut-3-en-2-yl)-5-(phenylmethoxymethyl)oxolane-2-thione |
| SMILES | C=CC(C)(C)C1CC(COCc2ccccc2)OC1=S |
| InChI | InChI=1S/C17H22O2S/c1-4-17(2,3)15-10-14(19-16(15)20)12-18-11-13-8-6-5-7-9-13/h4-9,14-15H,1,10-12H2,2-3H3 |
| InChIKey | YTYMIMGXGNLATR-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|