C24H24BrNO3 — CID 139218226
(1S,3R)-4'-bromo-1'-methyl-1-(phenylmethoxymethyl)spiro[4,5,6,7-tetrahydro-1H-cyclopenta[c]pyran-3,3'-indole]-2'-one (PubChem CID 139218226) has the molecular formula C24H24BrNO3 and a molecular weight of 454.36 g/mol. Its IUPAC name is (1S,3R)-4'-bromo-1'-methyl-1-(phenylmethoxymethyl)spiro[4,5,6,7-tetrahydro-1H-cyclopenta[c]pyran-3,3'-indole]-2'-one.
| Compound Name | (1S,3R)-4'-bromo-1'-methyl-1-(phenylmethoxymethyl)spiro[4,5,6,7-tetrahydro-1H-cyclopenta[c]pyran-3,3'-indole]-2'-one |
|---|---|
| PubChem CID | 139218226 |
| Molecular Formula | C24H24BrNO3 |
| Molecular Weight | 454.36 g/mol |
| Exact Mass | 453.09 |
| IUPAC Name | (1S,3R)-4'-bromo-1'-methyl-1-(phenylmethoxymethyl)spiro[4,5,6,7-tetrahydro-1H-cyclopenta[c]pyran-3,3'-indole]-2'-one |
| SMILES | CN1C(=O)[C@@]2(CC3=C(CCC3)[C@@H](COCc3ccccc3)O2)c2c(Br)cccc21 |
| InChI | InChI=1S/C24H24BrNO3/c1-26-20-12-6-11-19(25)22(20)24(23(26)27)13-17-9-5-10-18(17)21(29-24)15-28-14-16-7-3-2-4-8-16/h2-4,6-8,11-12,21H,5,9-10,13-15H2,1H3/t21-,24-/m1/s1 |
| InChIKey | LWSXRLBUXHYLPR-ZJSXRUAMSA-N |
| XLogP | 5.11 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.36 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|