C14H18O5 — CID 10989192
3,3-dimethoxy-5-(phenylmethoxymethyl)oxolan-2-one (PubChem CID 10989192) has the molecular formula C14H18O5 and a molecular weight of 266.29 g/mol. Its IUPAC name is 3,3-dimethoxy-5-(phenylmethoxymethyl)oxolan-2-one.
| Compound Name | 3,3-dimethoxy-5-(phenylmethoxymethyl)oxolan-2-one |
|---|---|
| PubChem CID | 10989192 |
| Molecular Formula | C14H18O5 |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | 3,3-dimethoxy-5-(phenylmethoxymethyl)oxolan-2-one |
| SMILES | COC1(OC)CC(COCc2ccccc2)OC1=O |
| InChI | InChI=1S/C14H18O5/c1-16-14(17-2)8-12(19-13(14)15)10-18-9-11-6-4-3-5-7-11/h3-7,12H,8-10H2,1-2H3 |
| InChIKey | AFBWGLZMZYSNOL-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|