C24H27N3O3 — CID 69036027
benzyl 3-amino-5-cyclohexyl-1-methyl-2-oxo-1,4-benzodiazepine-3-carboxylate (PubChem CID 69036027) has the molecular formula C24H27N3O3 and a molecular weight of 405.50 g/mol. Its IUPAC name is benzyl 3-amino-5-cyclohexyl-1-methyl-2-oxo-1,4-benzodiazepine-3-carboxylate.
| Compound Name | benzyl 3-amino-5-cyclohexyl-1-methyl-2-oxo-1,4-benzodiazepine-3-carboxylate |
|---|---|
| PubChem CID | 69036027 |
| Molecular Formula | C24H27N3O3 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | benzyl 3-amino-5-cyclohexyl-1-methyl-2-oxo-1,4-benzodiazepine-3-carboxylate |
| SMILES | CN1C(=O)C(N)(C(=O)OCc2ccccc2)N=C(C2CCCCC2)c2ccccc21 |
| InChI | InChI=1S/C24H27N3O3/c1-27-20-15-9-8-14-19(20)21(18-12-6-3-7-13-18)26-24(25,22(27)28)23(29)30-16-17-10-4-2-5-11-17/h2,4-5,8-11,14-15,18H,3,6-7,12-13,16,25H2,1H3 |
| InChIKey | XECIRBOUIIXGAS-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 84.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|