C26H37N3O3 — CID 90736807
3-amino-5-cyclopentyl-3-[(2R,3S)-2-(cyclopropylmethyl)-3-hydroxyheptanoyl]-1-methyl-1,4-benzodiazepin-2-one (PubChem CID 90736807) has the molecular formula C26H37N3O3 and a molecular weight of 439.60 g/mol. Its IUPAC name is 3-amino-5-cyclopentyl-3-[(2R,3S)-2-(cyclopropylmethyl)-3-hydroxyheptanoyl]-1-methyl-1,4-benzodiazepin-2-one.
| Compound Name | 3-amino-5-cyclopentyl-3-[(2R,3S)-2-(cyclopropylmethyl)-3-hydroxyheptanoyl]-1-methyl-1,4-benzodiazepin-2-one |
|---|---|
| PubChem CID | 90736807 |
| Molecular Formula | C26H37N3O3 |
| Molecular Weight | 439.60 g/mol |
| Exact Mass | 439.28 |
| IUPAC Name | 3-amino-5-cyclopentyl-3-[(2R,3S)-2-(cyclopropylmethyl)-3-hydroxyheptanoyl]-1-methyl-1,4-benzodiazepin-2-one |
| SMILES | CCCC[C@H](O)[C@@H](CC1CC1)C(=O)C1(N)N=C(C2CCCC2)c2ccccc2N(C)C1=O |
| InChI | InChI=1S/C26H37N3O3/c1-3-4-13-22(30)20(16-17-14-15-17)24(31)26(27)25(32)29(2)21-12-8-7-11-19(21)23(28-26)18-9-5-6-10-18/h7-8,11-12,17-18,20,22,30H,3-6,9-10,13-16,27H2,1-2H3/t20-,22+,26?/m1/s1 |
| InChIKey | XKSRBQDYKNJTJG-VBCRPWMOSA-N |
| XLogP | 3.83 |
| TPSA | 95.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.60 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|