C27H31N3O3 — CID 154175460
(3S)-3-amino-3-[(2R,3S)-2-(cyclopropylmethyl)-3-hydroxyhept-6-enoyl]-1-methyl-5-phenyl-1,4-benzodiazepin-2-one (PubChem CID 154175460) has the molecular formula C27H31N3O3 and a molecular weight of 445.56 g/mol. Its IUPAC name is (3S)-3-amino-3-[(2R,3S)-2-(cyclopropylmethyl)-3-hydroxyhept-6-enoyl]-1-methyl-5-phenyl-1,4-benzodiazepin-2-one.
| Compound Name | (3S)-3-amino-3-[(2R,3S)-2-(cyclopropylmethyl)-3-hydroxyhept-6-enoyl]-1-methyl-5-phenyl-1,4-benzodiazepin-2-one |
|---|---|
| PubChem CID | 154175460 |
| Molecular Formula | C27H31N3O3 |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.24 |
| IUPAC Name | (3S)-3-amino-3-[(2R,3S)-2-(cyclopropylmethyl)-3-hydroxyhept-6-enoyl]-1-methyl-5-phenyl-1,4-benzodiazepin-2-one |
| SMILES | C=CCC[C@H](O)[C@@H](CC1CC1)C(=O)[C@]1(N)N=C(c2ccccc2)c2ccccc2N(C)C1=O |
| InChI | InChI=1S/C27H31N3O3/c1-3-4-14-23(31)21(17-18-15-16-18)25(32)27(28)26(33)30(2)22-13-9-8-12-20(22)24(29-27)19-10-6-5-7-11-19/h3,5-13,18,21,23,31H,1,4,14-17,28H2,2H3/t21-,23+,27+/m1/s1 |
| InChIKey | WTEMHOCDNRMYTJ-ZYVVXELTSA-N |
| XLogP | 3.47 |
| TPSA | 95.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|