C27H35N3O2 — CID 174444052
1-[(3S)-1-amino-7-methyl-5-phenyl-2,3-dihydro-1,4-benzodiazepin-3-yl]-2-(cyclopropylmethyl)-3-hydroxyheptan-1-one (PubChem CID 174444052) has the molecular formula C27H35N3O2 and a molecular weight of 433.60 g/mol. Its IUPAC name is 1-[(3S)-1-amino-7-methyl-5-phenyl-2,3-dihydro-1,4-benzodiazepin-3-yl]-2-(cyclopropylmethyl)-3-hydroxyheptan-1-one.
| Compound Name | 1-[(3S)-1-amino-7-methyl-5-phenyl-2,3-dihydro-1,4-benzodiazepin-3-yl]-2-(cyclopropylmethyl)-3-hydroxyheptan-1-one |
|---|---|
| PubChem CID | 174444052 |
| Molecular Formula | C27H35N3O2 |
| Molecular Weight | 433.60 g/mol |
| Exact Mass | 433.27 |
| IUPAC Name | 1-[(3S)-1-amino-7-methyl-5-phenyl-2,3-dihydro-1,4-benzodiazepin-3-yl]-2-(cyclopropylmethyl)-3-hydroxyheptan-1-one |
| SMILES | CCCCC(O)C(CC1CC1)C(=O)[C@@H]1CN(N)c2ccc(C)cc2C(c2ccccc2)=N1 |
| InChI | InChI=1S/C27H35N3O2/c1-3-4-10-25(31)22(16-19-12-13-19)27(32)23-17-30(28)24-14-11-18(2)15-21(24)26(29-23)20-8-6-5-7-9-20/h5-9,11,14-15,19,22-23,25,31H,3-4,10,12-13,16-17,28H2,1-2H3/t22?,23-,25?/m0/s1 |
| InChIKey | FFDMFOCVKUQGEC-KJXWVISYSA-N |
| XLogP | 4.43 |
| TPSA | 78.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.60 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|