About 4'-hydroxy-6'-propylspiro[1H-indole-3,2'-oxane]-2-one
4'-hydroxy-6'-propylspiro[1H-indole-3,2'-oxane]-2-one (PubChem CID 123548047) has the molecular formula C15H19NO3
and a molecular weight of 261.32 g/mol. Its IUPAC name is 4'-hydroxy-6'-propylspiro[1H-indole-3,2'-oxane]-2-one.
Molecular Properties
| Compound Name | 4'-hydroxy-6'-propylspiro[1H-indole-3,2'-oxane]-2-one |
| PubChem CID | 123548047 |
| Molecular Formula | C15H19NO3 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | 4'-hydroxy-6'-propylspiro[1H-indole-3,2'-oxane]-2-one |
| SMILES | CCCC1CC(O)CC2(O1)C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C15H19NO3/c1-2-5-11-8-10(17)9-15(19-11)12-6-3-4-7-13(12)16-14(15)18/h3-4,6-7,10-11,17H,2,5,8-9H2,1H3,(H,16,18) |
| InChIKey | IFNMAHILDZXMOC-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4'-hydroxy-6'-propylspiro[1H-indole-3,2'-oxane]-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4'-hydroxy-6'-propylspiro[1H-indole-3,2'-oxane]-2-one?
The IUPAC name of 4'-hydroxy-6'-propylspiro[1H-indole-3,2'-oxane]-2-one (CID 123548047) is 4'-hydroxy-6'-propylspiro[1H-indole-3,2'-oxane]-2-one.
What is the SMILES notation for 4'-hydroxy-6'-propylspiro[1H-indole-3,2'-oxane]-2-one?
The canonical SMILES for 4'-hydroxy-6'-propylspiro[1H-indole-3,2'-oxane]-2-one is CCCC1CC(O)CC2(O1)C(=O)Nc1ccccc12.
What is the InChIKey of 4'-hydroxy-6'-propylspiro[1H-indole-3,2'-oxane]-2-one?
The InChIKey is IFNMAHILDZXMOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19NO3/c1-2-5-11-8-10(17)9-15(19-11)12-6-3-4-7-13(12)16-14(15)18/h3-4,6-7,10-11,17H,2,5,8-9H2,1H3,(H,16,18).
What are the key properties of 4'-hydroxy-6'-propylspiro[1H-indole-3,2'-oxane]-2-one?
4'-hydroxy-6'-propylspiro[1H-indole-3,2'-oxane]-2-one has a molecular weight of 261.32 g/mol, XLogP of 2.17, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4'-hydroxy-6'-propylspiro[1H-indole-3,2'-oxane]-2-one is sourced from PubChem (CID 123548047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).