C15H19NO3 — CID 123548047
4'-hydroxy-6'-propylspiro[1H-indole-3,2'-oxane]-2-one (PubChem CID 123548047) has the molecular formula C15H19NO3 and a molecular weight of 261.32 g/mol. Its IUPAC name is 4'-hydroxy-6'-propylspiro[1H-indole-3,2'-oxane]-2-one.
| Compound Name | 4'-hydroxy-6'-propylspiro[1H-indole-3,2'-oxane]-2-one |
|---|---|
| PubChem CID | 123548047 |
| Molecular Formula | C15H19NO3 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | 4'-hydroxy-6'-propylspiro[1H-indole-3,2'-oxane]-2-one |
| SMILES | CCCC1CC(O)CC2(O1)C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C15H19NO3/c1-2-5-11-8-10(17)9-15(19-11)12-6-3-4-7-13(12)16-14(15)18/h3-4,6-7,10-11,17H,2,5,8-9H2,1H3,(H,16,18) |
| InChIKey | IFNMAHILDZXMOC-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |