C12H11NO3 — CID 132577226
4-methylspiro[1H-indole-3,5'-oxolane]-2,2'-dione (PubChem CID 132577226) has the molecular formula C12H11NO3 and a molecular weight of 217.22 g/mol. Its IUPAC name is 4-methylspiro[1H-indole-3,5'-oxolane]-2,2'-dione.
| Compound Name | 4-methylspiro[1H-indole-3,5'-oxolane]-2,2'-dione |
|---|---|
| PubChem CID | 132577226 |
| Molecular Formula | C12H11NO3 |
| Molecular Weight | 217.22 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | 4-methylspiro[1H-indole-3,5'-oxolane]-2,2'-dione |
| SMILES | Cc1cccc2c1C1(CCC(=O)O1)C(=O)N2 |
| InChI | InChI=1S/C12H11NO3/c1-7-3-2-4-8-10(7)12(11(15)13-8)6-5-9(14)16-12/h2-4H,5-6H2,1H3,(H,13,15) |
| InChIKey | KQQWPDBKPIGDKM-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.22 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |