C24H20N4O — CID 143808285
5-[(6-but-3-ynylpyrimidin-4-yl)amino]spiro[1,3-dihydroindene-2,3'-1H-indole]-2'-one (PubChem CID 143808285) has the molecular formula C24H20N4O and a molecular weight of 380.45 g/mol. Its IUPAC name is 5-[(6-but-3-ynylpyrimidin-4-yl)amino]spiro[1,3-dihydroindene-2,3'-1H-indole]-2'-one.
| Compound Name | 5-[(6-but-3-ynylpyrimidin-4-yl)amino]spiro[1,3-dihydroindene-2,3'-1H-indole]-2'-one |
|---|---|
| PubChem CID | 143808285 |
| Molecular Formula | C24H20N4O |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | 5-[(6-but-3-ynylpyrimidin-4-yl)amino]spiro[1,3-dihydroindene-2,3'-1H-indole]-2'-one |
| SMILES | C#CCCc1cc(Nc2ccc3c(c2)CC2(C3)C(=O)Nc3ccccc32)ncn1 |
| InChI | InChI=1S/C24H20N4O/c1-2-3-6-18-12-22(26-15-25-18)27-19-10-9-16-13-24(14-17(16)11-19)20-7-4-5-8-21(20)28-23(24)29/h1,4-5,7-12,15H,3,6,13-14H2,(H,28,29)(H,25,26,27) |
| InChIKey | JYSRODBIDGEHLU-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|