C15H17NO5 — CID 25211439
2-[2-[(2S,4R,6S)-4,6-dihydroxyoxan-2-yl]ethyl]isoindole-1,3-dione (PubChem CID 25211439) has the molecular formula C15H17NO5 and a molecular weight of 291.30 g/mol. Its IUPAC name is 2-[2-[(2S,4R,6S)-4,6-dihydroxyoxan-2-yl]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[(2S,4R,6S)-4,6-dihydroxyoxan-2-yl]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 25211439 |
| Molecular Formula | C15H17NO5 |
| Molecular Weight | 291.30 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 2-[2-[(2S,4R,6S)-4,6-dihydroxyoxan-2-yl]ethyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CC[C@H]1C[C@@H](O)C[C@@H](O)O1 |
| InChI | InChI=1S/C15H17NO5/c17-9-7-10(21-13(18)8-9)5-6-16-14(19)11-3-1-2-4-12(11)15(16)20/h1-4,9-10,13,17-18H,5-8H2/t9-,10+,13+/m1/s1 |
| InChIKey | IQEXBIDWHNIJHJ-NRUUGDAUSA-N |
| XLogP | 0.53 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.30 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|