C13H12BNO4 — CID 135010027
CID 135010027 (PubChem CID 135010027) has the molecular formula C13H12BNO4 and a molecular weight of 257.05 g/mol.
| Compound Name | CID 135010027 |
|---|---|
| PubChem CID | 135010027 |
| Molecular Formula | C13H12BNO4 |
| Molecular Weight | 257.05 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | — |
| SMILES | [B][C@H]1C[C@@H](O)[C@@H](CN2C(=O)c3ccccc3C2=O)O1 |
| InChI | InChI=1S/C13H12BNO4/c14-11-5-9(16)10(19-11)6-15-12(17)7-3-1-2-4-8(7)13(15)18/h1-4,9-11,16H,5-6H2/t9-,10-,11-/m1/s1 |
| InChIKey | FEFWROMHUQTNLR-GMTAPVOTSA-N |
| XLogP | -0.07 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.05 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|