C12H11NO2S2 — CID 135060706
2-(1,3-dithiolan-2-ylmethyl)isoindole-1,3-dione (PubChem CID 135060706) has the molecular formula C12H11NO2S2 and a molecular weight of 265.36 g/mol. Its IUPAC name is 2-(1,3-dithiolan-2-ylmethyl)isoindole-1,3-dione.
| Compound Name | 2-(1,3-dithiolan-2-ylmethyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 135060706 |
| Molecular Formula | C12H11NO2S2 |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.02 |
| IUPAC Name | 2-(1,3-dithiolan-2-ylmethyl)isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CC1SCCS1 |
| InChI | InChI=1S/C12H11NO2S2/c14-11-8-3-1-2-4-9(8)12(15)13(11)7-10-16-5-6-17-10/h1-4,10H,5-7H2 |
| InChIKey | QMFGSVJMGXMZIF-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|