C15H16ClNO4S — CID 146279114
4-[(1,3-dioxoisoindol-2-yl)methyl]cyclohexane-1-sulfonyl chloride (PubChem CID 146279114) has the molecular formula C15H16ClNO4S and a molecular weight of 341.82 g/mol. Its IUPAC name is 4-[(1,3-dioxoisoindol-2-yl)methyl]cyclohexane-1-sulfonyl chloride.
| Compound Name | 4-[(1,3-dioxoisoindol-2-yl)methyl]cyclohexane-1-sulfonyl chloride |
|---|---|
| PubChem CID | 146279114 |
| Molecular Formula | C15H16ClNO4S |
| Molecular Weight | 341.82 g/mol |
| Exact Mass | 341.05 |
| IUPAC Name | 4-[(1,3-dioxoisoindol-2-yl)methyl]cyclohexane-1-sulfonyl chloride |
| SMILES | O=C1c2ccccc2C(=O)N1CC1CCC(S(=O)(=O)Cl)CC1 |
| InChI | InChI=1S/C15H16ClNO4S/c16-22(20,21)11-7-5-10(6-8-11)9-17-14(18)12-3-1-2-4-13(12)15(17)19/h1-4,10-11H,5-9H2 |
| InChIKey | MZIMWGJEWQNZEI-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.82 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|