C17H17N3O2S — CID 99872305
2-[[(3S)-1-(1,3-thiazol-2-yl)piperidin-3-yl]methyl]isoindole-1,3-dione (PubChem CID 99872305) has the molecular formula C17H17N3O2S and a molecular weight of 327.41 g/mol. Its IUPAC name is 2-[[(3S)-1-(1,3-thiazol-2-yl)piperidin-3-yl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[(3S)-1-(1,3-thiazol-2-yl)piperidin-3-yl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 99872305 |
| Molecular Formula | C17H17N3O2S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | 2-[[(3S)-1-(1,3-thiazol-2-yl)piperidin-3-yl]methyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1C[C@@H]1CCCN(c2nccs2)C1 |
| InChI | InChI=1S/C17H17N3O2S/c21-15-13-5-1-2-6-14(13)16(22)20(15)11-12-4-3-8-19(10-12)17-18-7-9-23-17/h1-2,5-7,9,12H,3-4,8,10-11H2/t12-/m1/s1 |
| InChIKey | LRYYGPQPBFHDSM-GFCCVEGCSA-N |
| XLogP | 2.66 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|