C16H18F2N2S — CID 95866929
2-[(3R)-3-[2-(2,4-difluorophenyl)ethyl]piperidin-1-yl]-1,3-thiazole (PubChem CID 95866929) has the molecular formula C16H18F2N2S and a molecular weight of 308.40 g/mol. Its IUPAC name is 2-[(3R)-3-[2-(2,4-difluorophenyl)ethyl]piperidin-1-yl]-1,3-thiazole.
| Compound Name | 2-[(3R)-3-[2-(2,4-difluorophenyl)ethyl]piperidin-1-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 95866929 |
| Molecular Formula | C16H18F2N2S |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | 2-[(3R)-3-[2-(2,4-difluorophenyl)ethyl]piperidin-1-yl]-1,3-thiazole |
| SMILES | Fc1ccc(CC[C@@H]2CCCN(c3nccs3)C2)c(F)c1 |
| InChI | InChI=1S/C16H18F2N2S/c17-14-6-5-13(15(18)10-14)4-3-12-2-1-8-20(11-12)16-19-7-9-21-16/h5-7,9-10,12H,1-4,8,11H2/t12-/m0/s1 |
| InChIKey | GWORSFOAONSZNV-LBPRGKRZSA-N |
| XLogP | 4.27 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |