C19H19N3O6 — CID 10738848
ethyl 4-[(2R,4S,5R)-5-[(1,3-dioxoisoindol-2-yl)methyl]-4-hydroxyoxolan-2-yl]imidazole-1-carboxylate (PubChem CID 10738848) has the molecular formula C19H19N3O6 and a molecular weight of 385.38 g/mol. Its IUPAC name is ethyl 4-[(2R,4S,5R)-5-[(1,3-dioxoisoindol-2-yl)methyl]-4-hydroxyoxolan-2-yl]imidazole-1-carboxylate.
| Compound Name | ethyl 4-[(2R,4S,5R)-5-[(1,3-dioxoisoindol-2-yl)methyl]-4-hydroxyoxolan-2-yl]imidazole-1-carboxylate |
|---|---|
| PubChem CID | 10738848 |
| Molecular Formula | C19H19N3O6 |
| Molecular Weight | 385.38 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | ethyl 4-[(2R,4S,5R)-5-[(1,3-dioxoisoindol-2-yl)methyl]-4-hydroxyoxolan-2-yl]imidazole-1-carboxylate |
| SMILES | CCOC(=O)n1cnc([C@H]2C[C@H](O)[C@@H](CN3C(=O)c4ccccc4C3=O)O2)c1 |
| InChI | InChI=1S/C19H19N3O6/c1-2-27-19(26)21-8-13(20-10-21)15-7-14(23)16(28-15)9-22-17(24)11-5-3-4-6-12(11)18(22)25/h3-6,8,10,14-16,23H,2,7,9H2,1H3/t14-,15+,16+/m0/s1 |
| InChIKey | RGEKAUMNCXLYKT-ARFHVFGLSA-N |
| XLogP | 1.37 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.38 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|