C13H14N2O4 — CID 79420634
2-[[(3R,4S)-3,4-dihydroxypyrrolidin-1-yl]methyl]isoindole-1,3-dione (PubChem CID 79420634) has the molecular formula C13H14N2O4 and a molecular weight of 262.26 g/mol. Its IUPAC name is 2-[[(3R,4S)-3,4-dihydroxypyrrolidin-1-yl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[(3R,4S)-3,4-dihydroxypyrrolidin-1-yl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 79420634 |
| Molecular Formula | C13H14N2O4 |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | 2-[[(3R,4S)-3,4-dihydroxypyrrolidin-1-yl]methyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CN1C[C@@H](O)[C@@H](O)C1 |
| InChI | InChI=1S/C13H14N2O4/c16-10-5-14(6-11(10)17)7-15-12(18)8-3-1-2-4-9(8)13(15)19/h1-4,10-11,16-17H,5-7H2/t10-,11+ |
| InChIKey | NUBYMSKYCOAHRV-PHIMTYICSA-N |
| XLogP | -0.72 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|