C16H20FNO2 — CID 2784364
3-fluoro-3-heptyl-1H-quinoline-2,4-dione (PubChem CID 2784364) has the molecular formula C16H20FNO2 and a molecular weight of 277.34 g/mol. Its IUPAC name is 3-fluoro-3-heptyl-1H-quinoline-2,4-dione.
| Compound Name | 3-fluoro-3-heptyl-1H-quinoline-2,4-dione |
|---|---|
| PubChem CID | 2784364 |
| Molecular Formula | C16H20FNO2 |
| Molecular Weight | 277.34 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | 3-fluoro-3-heptyl-1H-quinoline-2,4-dione |
| SMILES | CCCCCCCC1(F)C(=O)Nc2ccccc2C1=O |
| InChI | InChI=1S/C16H20FNO2/c1-2-3-4-5-8-11-16(17)14(19)12-9-6-7-10-13(12)18-15(16)20/h6-7,9-10H,2-5,8,11H2,1H3,(H,18,20) |
| InChIKey | KWRIKJRHNPWJPR-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.34 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|